cas: 23399-77-1 — see every product listed under this CAS number, including other names
5-Chloro-2-iodobenzotrifluoride 98% (CAS 23399-77-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A687129-5g |
| cas | 23399-77-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 414.88 Pln | |
| Ambeed | 500g | 1772.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A687129 |
4-chloro-1-iodo-2-(trifluoromethyl)benzene (CAS 23399-77-1) is a chemical compound with the molecular formula C7H3ClF3I and a molecular weight of 306.45 g/mol. IUPAC name: 4-chloro-1-iodo-2-(trifluoromethyl)benzene. InChIKey: DRMQJFVDZWIKTE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3I |
|---|---|
| Molecular weight | 306.45 g/mol |
| IUPAC name | 4-chloro-1-iodo-2-(trifluoromethyl)benzene |
| InChIKey | DRMQJFVDZWIKTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)I |
Computed by PubChem (NCBI)