cas: 23399-77-1 — see every product listed under this CAS number, including other names
5-Chloro-2-iodobenzotrifluoride, 96% (CAS 23399-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004485-1G |
| cas | 23399-77-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 393.63 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-1-iodo-2-(trifluoromethyl)benzene (CAS 23399-77-1) is a chemical compound with the molecular formula C7H3ClF3I and a molecular weight of 306.45 g/mol. IUPAC name: 4-chloro-1-iodo-2-(trifluoromethyl)benzene. InChIKey: DRMQJFVDZWIKTE-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3I |
|---|---|
| Molecular weight | 306.45 g/mol |
| IUPAC name | 4-chloro-1-iodo-2-(trifluoromethyl)benzene |
| InChIKey | DRMQJFVDZWIKTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)I |
Computed by PubChem (NCBI)