cas: 1083168-96-0 — see every product listed under this CAS number, including other names
5-Chloro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 1083168-96-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A623170-100mg |
| cas | 1083168-96-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2689.94 Pln | |
| Ambeed | 25g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A623170 |
5-chloro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1083168-96-0) is a chemical compound with the molecular formula C12H17BClNO3 and a molecular weight of 269.53 g/mol. IUPAC name: 5-chloro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XEOYFUBNOQGVKM-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO3 |
|---|---|
| Molecular weight | 269.53 g/mol |
| IUPAC name | 5-chloro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XEOYFUBNOQGVKM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OC)Cl |
Computed by PubChem (NCBI)