cas: 60367-52-4 — see every product listed under this CAS number, including other names
5-Chloro-2-phenylimidazole-4-carbaldehyde 98% (CAS 60367-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A819682-250mg |
| cas | 60367-52-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A819682 |
5-chloro-2-phenyl-1H-imidazole-4-carbaldehyde (CAS 60367-52-4) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 5-chloro-2-phenyl-1H-imidazole-4-carbaldehyde. InChIKey: CCXUATWKEDQRMP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 5-chloro-2-phenyl-1H-imidazole-4-carbaldehyde |
| InChIKey | CCXUATWKEDQRMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(N2)Cl)C=O |
Computed by PubChem (NCBI)