5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tosyl-1H-pyrrolo[2,3-b]pyridine, 97%
cas: 866546-11-4 — see every product listed under this CAS number, including other names
5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tosyl-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 866546-11-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch115TXR-100mg |
| cas | 866546-11-4 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1902.80 Pln | |
| Chemat | 10g | 3558.80 Pln | |
| Chemat | 25g | 8594.00 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 2934.40 Pln | |
| Fluorochem | 10g | 4756.68 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (CAS 866546-11-4) is a chemical compound with the molecular formula C20H22BClN2O4S and a molecular weight of 432.7 g/mol. IUPAC name: 5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine. InChIKey: FYARTQIITABLRT-UHFFFAOYSA-N.
| Molecular formula | C20H22BClN2O4S |
|---|---|
| Molecular weight | 432.7 g/mol |
| IUPAC name | 5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| InChIKey | FYARTQIITABLRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=C(C=N3)Cl)S(=O)(=O)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)