cas: 1400994-91-3 — see every product listed under this CAS number, including other names
5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97% (CAS 1400994-91-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVQM-250mg |
| cas | 1400994-91-3 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1394.00 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 25g | 5882.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (CAS 1400994-91-3) is a chemical compound with the molecular formula C13H16BClN2O2 and a molecular weight of 278.54 g/mol. IUPAC name: 5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: ZYKSLJNKWGNLIJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BClN2O2 |
|---|---|
| Molecular weight | 278.54 g/mol |
| IUPAC name | 5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | ZYKSLJNKWGNLIJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC3=C2C=C(C=N3)Cl |
Computed by PubChem (NCBI)