cas: 887623-87-2 — see every product listed under this CAS number, including other names
5-Chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole, 98%, 98% (CAS 887623-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H502-100mg |
| cas | 887623-87-2 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 1g | 1499.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole (CAS 887623-87-2) is a chemical compound with the molecular formula C8H4Cl2N2S and a molecular weight of 231.10 g/mol. IUPAC name: 5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole. InChIKey: MZLWEBFWFODGTC-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole |
| InChIKey | MZLWEBFWFODGTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)Cl)Cl |
Computed by PubChem (NCBI)