CAS 887623-87-2 appears in our catalog under these names: 5-Chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole, 95%, 5-Chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole, 98+%, 5-Chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole, 98%, 98%, 5-Chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 10g.
5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole (CAS 887623-87-2) is a chemical compound with the molecular formula C8H4Cl2N2S and a molecular weight of 231.10 g/mol. IUPAC name: 5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole. InChIKey: MZLWEBFWFODGTC-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 5-chloro-3-(4-chlorophenyl)-1,2,4-thiadiazole |
| InChIKey | MZLWEBFWFODGTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)Cl)Cl |
Computed by PubChem (NCBI)