CAS 1202993-11-0 appears in our catalog under these names: 5–Chloro–3–(difluoromethyl)–1–methyl–1H–pyrazole–4–carboxylic acid, 5-Chloro-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 97%, 97%, 5-Chloro-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
5-chloro-3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid (CAS 1202993-11-0) is a chemical compound with the molecular formula C6H5ClF2N2O2 and a molecular weight of 210.56 g/mol. IUPAC name: 5-chloro-3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid. InChIKey: VXTQDSCLSCPLPV-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF2N2O2 |
|---|---|
| Molecular weight | 210.56 g/mol |
| IUPAC name | 5-chloro-3-(difluoromethyl)-1-methylpyrazole-4-carboxylic acid |
| InChIKey | VXTQDSCLSCPLPV-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)