Products 1006486-42-5

CAS 1006486-42-5 is the registry number for 4-Chloro-1-(2,2-difluoroethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid (CAS 1006486-42-5) is a chemical compound with the molecular formula C6H5ClF2N2O2 and a molecular weight of 210.56 g/mol. IUPAC name: 4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid. InChIKey: YOELFGBALFGCCR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClF2N2O2
Molecular weight210.56 g/mol
IUPAC name4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid
InChIKeyYOELFGBALFGCCR-UHFFFAOYSA-N
SMILESC1=C(C(=NN1CC(F)F)C(=O)O)Cl

Computed by PubChem (NCBI)