CAS 1006486-42-5 is the registry number for 4-Chloro-1-(2,2-difluoroethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid (CAS 1006486-42-5) is a chemical compound with the molecular formula C6H5ClF2N2O2 and a molecular weight of 210.56 g/mol. IUPAC name: 4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid. InChIKey: YOELFGBALFGCCR-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF2N2O2 |
|---|---|
| Molecular weight | 210.56 g/mol |
| IUPAC name | 4-chloro-1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | YOELFGBALFGCCR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)