cas: 1352457-23-8 — see every product listed under this CAS number, including other names
5-Chloro-3-fluoro-2-nitrobenzenamine, 97%, 97% (CAS 1352457-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EJTG-1g |
| cas | 1352457-23-8 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 981.20 Pln | |
| Chemat | 100mg | 165.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-fluoro-2-nitroaniline (CAS 1352457-23-8) is a chemical compound with the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. IUPAC name: 5-chloro-3-fluoro-2-nitroaniline. InChIKey: GIOPZRJOGOUPMU-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFN2O2 |
|---|---|
| Molecular weight | 190.56 g/mol |
| IUPAC name | 5-chloro-3-fluoro-2-nitroaniline |
| InChIKey | GIOPZRJOGOUPMU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)[N+](=O)[O-])F)Cl |
Computed by PubChem (NCBI)