CAS 1095824-77-3 appears in our catalog under these names: 5-Chloro-4-(trifluoromethyl)pyridin-2-amine hydrochloride, 95%, 5–Chloro–4–(trifluoromethyl)pyridin–2–amine hydrochloride, 5-Chloro-4-(trifluoromethyl)pyridin-2-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g, 100g.
5-chloro-4-(trifluoromethyl)pyridin-2-amine;hydrochloride (CAS 1095824-77-3) is a chemical compound with the molecular formula C6H5Cl2F3N2 and a molecular weight of 233.02 g/mol. IUPAC name: 5-chloro-4-(trifluoromethyl)pyridin-2-amine;hydrochloride. InChIKey: BGFRWTOLXXYTIQ-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2F3N2 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 5-chloro-4-(trifluoromethyl)pyridin-2-amine;hydrochloride |
| InChIKey | BGFRWTOLXXYTIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)Cl)C(F)(F)F.Cl |
Computed by PubChem (NCBI)