CAS 2260937-47-9 is the registry number for 6-Chloro-2-(trifluoromethyl)pyridin-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-chloro-2-(trifluoromethyl)pyridin-3-amine;hydrochloride (CAS 2260937-47-9) is a chemical compound with the molecular formula C6H5Cl2F3N2 and a molecular weight of 233.02 g/mol. IUPAC name: 6-chloro-2-(trifluoromethyl)pyridin-3-amine;hydrochloride. InChIKey: FPIYVQDZEQWZQW-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2F3N2 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethyl)pyridin-3-amine;hydrochloride |
| InChIKey | FPIYVQDZEQWZQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1N)C(F)(F)F)Cl.Cl |
Computed by PubChem (NCBI)