cas: 57531-38-1 — see every product listed under this CAS number, including other names
5-Chloro-4-nitro-1H-imidazole 95% (CAS 57531-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A785971-100mg |
| cas | 57531-38-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 976.69 Pln | |
| Ambeed | 10g | 1877.81 Pln | |
| Ambeed | 25g | 3618.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A785971 |
4-chloro-5-nitro-1H-imidazole (CAS 57531-38-1) is a chemical compound with the molecular formula C3H2ClN3O2 and a molecular weight of 147.52 g/mol. IUPAC name: 4-chloro-5-nitro-1H-imidazole. InChIKey: ZJYZSKPVPVBBFB-UHFFFAOYSA-N.
| Molecular formula | C3H2ClN3O2 |
|---|---|
| Molecular weight | 147.52 g/mol |
| IUPAC name | 4-chloro-5-nitro-1H-imidazole |
| InChIKey | ZJYZSKPVPVBBFB-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)