cas: 89166-85-8 — see every product listed under this CAS number, including other names
5-Chloro-4-nitrothiophene-2-carboxylic acid, 95%, 95% (CAS 89166-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11705Q-100mg |
| cas | 89166-85-8 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1168.40 Pln | |
| Chemat | 10g | 1811.60 Pln | |
| Chemat | 25g | 3736.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-4-nitrothiophene-2-carboxylic acid (CAS 89166-85-8) is a chemical compound with the molecular formula C5H2ClNO4S and a molecular weight of 207.59 g/mol. IUPAC name: 5-chloro-4-nitrothiophene-2-carboxylic acid. InChIKey: FZKDYXWPDMALDM-UHFFFAOYSA-N.
| Molecular formula | C5H2ClNO4S |
|---|---|
| Molecular weight | 207.59 g/mol |
| IUPAC name | 5-chloro-4-nitrothiophene-2-carboxylic acid |
| InChIKey | FZKDYXWPDMALDM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)