5-Chloro-4-nitrothiophene-2-carboxylic acid, 97%
cas: 89166-85-8 — see every product listed under this CAS number, including other names
5-Chloro-4-nitrothiophene-2-carboxylic acid, 97% (CAS 89166-85-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078797-250MG |
| cas | 89166-85-8 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1226.67 Pln | |
| Fluorochem | 10g | 2283.59 Pln | |
| Fluorochem | 25g | 3949.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-4-nitrothiophene-2-carboxylic acid (CAS 89166-85-8) is a chemical compound with the molecular formula C5H2ClNO4S and a molecular weight of 207.59 g/mol. IUPAC name: 5-chloro-4-nitrothiophene-2-carboxylic acid. InChIKey: FZKDYXWPDMALDM-UHFFFAOYSA-N.
| Molecular formula | C5H2ClNO4S |
|---|---|
| Molecular weight | 207.59 g/mol |
| IUPAC name | 5-chloro-4-nitrothiophene-2-carboxylic acid |
| InChIKey | FZKDYXWPDMALDM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)