cas: 1210-33-9 — see every product listed under this CAS number, including other names
5-Chlorodibenzosuberane 98% (CAS 1210-33-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A472139-1g |
| cas | 1210-33-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 659.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A472139 |
2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (CAS 1210-33-9) is a chemical compound with the molecular formula C15H13Cl and a molecular weight of 228.71 g/mol. IUPAC name: 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene. InChIKey: QPERNSDCEUTOTE-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| InChIKey | QPERNSDCEUTOTE-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)Cl |
Computed by PubChem (NCBI)