cas: 652148-93-1 — see every product listed under this CAS number, including other names
5-Chloropyridine-2-boronic acid, pinacol ester (CAS 652148-93-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAD2-100mg |
| cas | 652148-93-1 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 3707.60 Pln | |
| Chemat | 250mg | 5262.80 Pln |
| delivery time | 3 weeks |
|---|
5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 652148-93-1) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RWOCXFPQPISTSD-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RWOCXFPQPISTSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)