cas: 1218791-27-5 — see every product listed under this CAS number, including other names
5-Cyano-2-nitrophenylboronic acid, pinacol ester, 98%, 98% (CAS 1218791-27-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127AM-250mg |
| cas | 1218791-27-5 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1038.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1218791-27-5) is a chemical compound with the molecular formula C13H15BN2O4 and a molecular weight of 274.08 g/mol. IUPAC name: 4-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: XGIWPDLRNUKSKD-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O4 |
|---|---|
| Molecular weight | 274.08 g/mol |
| IUPAC name | 4-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | XGIWPDLRNUKSKD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)