cas: 1586045-56-8 — see every product listed under this CAS number, including other names
5-Cyclopropyl-2-fluorophenylboronic acid, 95%, 95% (CAS 1586045-56-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYHZ-25mg |
| cas | 1586045-56-8 |
| size | 25mg |
| availability | 0.04g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 1163.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5-cyclopropyl-2-fluorophenyl)boronic acid (CAS 1586045-56-8) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (5-cyclopropyl-2-fluorophenyl)boronic acid. InChIKey: PSCZYVJGVXSRIY-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (5-cyclopropyl-2-fluorophenyl)boronic acid |
| InChIKey | PSCZYVJGVXSRIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2CC2)F)(O)O |
Computed by PubChem (NCBI)