CAS 1586045-56-8 appears in our catalog under these names: 5-Cyclopropyl-2-fluorophenylboronic acid, 95%, (5–cyclopropyl–2–fluorophenyl)boronic acid, 5-Cyclopropyl-2-fluorophenylboronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 10mg, 25mg.
(5-cyclopropyl-2-fluorophenyl)boronic acid (CAS 1586045-56-8) is a chemical compound with the molecular formula C9H10BFO2 and a molecular weight of 179.99 g/mol. IUPAC name: (5-cyclopropyl-2-fluorophenyl)boronic acid. InChIKey: PSCZYVJGVXSRIY-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO2 |
|---|---|
| Molecular weight | 179.99 g/mol |
| IUPAC name | (5-cyclopropyl-2-fluorophenyl)boronic acid |
| InChIKey | PSCZYVJGVXSRIY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2CC2)F)(O)O |
Computed by PubChem (NCBI)