cas: 1610964-64-1 — see every product listed under this CAS number, including other names
5-Fluoro-2-(6-fluoro-2-methyl-1H-benzoimidazol-1-yl)-N-(4-trifluoromethylphenyl)-pyrimidine-4,6-diamine, 98+%, 98+% (CAS 1610964-64-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12LIAP-10mg |
| cas | 1610964-64-1 |
| size | 10mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 645.20 Pln | |
| Chemat | 25mg | 1058.00 Pln | |
| Chemat | 50mg | 1749.20 Pln | |
| Chemat | 100mg | 2934.80 Pln | |
| Chemat | 1mg | 309.20 Pln | |
| Chemat | 5mg | 381.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (CAS 1610964-64-1) is a chemical compound with the molecular formula C19H13F5N6 and a molecular weight of 420.3 g/mol. IUPAC name: 5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine. InChIKey: TWLWOOPCEXYVBE-UHFFFAOYSA-N.
| Molecular formula | C19H13F5N6 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | 5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| InChIKey | TWLWOOPCEXYVBE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C3=NC(=C(C(=N3)NC4=CC=C(C=C4)C(F)(F)F)F)N)C=C(C=C2)F |
Computed by PubChem (NCBI)