Unesbulin, 99.17%
cas: 1610964-64-1 — see every product listed under this CAS number, including other names
Unesbulin, 99.17% (CAS 1610964-64-1) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 25 mg, 50 mg, 1 mg, 10 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-112041-10mM/1mL |
| cas | 1610964-64-1 |
| size | 10mM/1mL |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1387.81 Pln | |
| MedChemExpress | 100 mg | 7318.20 Pln | |
| MedChemExpress | 25 mg | 3477.61 Pln | |
| MedChemExpress | 50 mg | 5158.74 Pln | |
| MedChemExpress | 1 mg | 649.42 Pln | |
| MedChemExpress | 10 mg | 1945.09 Pln | |
| MedChemExpress | 5 mg | 1271.71 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.17% |
5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (CAS 1610964-64-1) is a chemical compound with the molecular formula C19H13F5N6 and a molecular weight of 420.3 g/mol. IUPAC name: 5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine. InChIKey: TWLWOOPCEXYVBE-UHFFFAOYSA-N.
| Molecular formula | C19H13F5N6 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | 5-fluoro-2-(6-fluoro-2-methylbenzimidazol-1-yl)-4-N-[4-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| InChIKey | TWLWOOPCEXYVBE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C3=NC(=C(C(=N3)NC4=CC=C(C=C4)C(F)(F)F)F)N)C=C(C=C2)F |
Computed by PubChem (NCBI)