cas: 1293284-57-7 — see every product listed under this CAS number, including other names
5-Fluoro-2-(pyrimidin-2-yl)benzoic acid, 95%, 95% (CAS 1293284-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DHBF-100mg |
| cas | 1293284-57-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1269.20 Pln | |
| Chemat | 250mg | 2474.00 Pln | |
| Chemat | 1g | 6818.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-pyrimidin-2-ylbenzoic acid (CAS 1293284-57-7) is a chemical compound with the molecular formula C11H7FN2O2 and a molecular weight of 218.18 g/mol. IUPAC name: 5-fluoro-2-pyrimidin-2-ylbenzoic acid. InChIKey: GWFSRJKDYXADOG-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O2 |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 5-fluoro-2-pyrimidin-2-ylbenzoic acid |
| InChIKey | GWFSRJKDYXADOG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)