CAS 1293284-57-7 appears in our catalog under these names: 5-Fluoro-2-(pyrimidin-2-yl)benzoic acid, 95%, 5–Fluoro–2–(pyrimidin–2–yl)benzoic acid, 5-Fluoro-2-(pyrimidin-2-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
5-fluoro-2-pyrimidin-2-ylbenzoic acid (CAS 1293284-57-7) is a chemical compound with the molecular formula C11H7FN2O2 and a molecular weight of 218.18 g/mol. IUPAC name: 5-fluoro-2-pyrimidin-2-ylbenzoic acid. InChIKey: GWFSRJKDYXADOG-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O2 |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 5-fluoro-2-pyrimidin-2-ylbenzoic acid |
| InChIKey | GWFSRJKDYXADOG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)