cas: 2306268-35-7 — see every product listed under this CAS number, including other names
5-Fluoroindolin-7-amine dihydrochloride, 97% (CAS 2306268-35-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1225185-5g |
| cas | 2306268-35-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5447.26 Pln | |
| AmBeed | 10g | 9027.76 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride (CAS 2306268-35-7) is a chemical compound with the molecular formula C8H11Cl2FN2 and a molecular weight of 225.09 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride. InChIKey: JUZZRTQOQRSAJA-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2FN2 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1H-indol-7-amine;dihydrochloride |
| InChIKey | JUZZRTQOQRSAJA-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2N)F.Cl.Cl |
Computed by PubChem (NCBI)