CAS 1073372-10-7 is the registry number for 5-Chloro-3-fluoro-2-(N-isopropylamino)pyridine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
5-chloro-3-fluoro-N-propan-2-ylpyridin-2-amine;hydrochloride (CAS 1073372-10-7) is a chemical compound with the molecular formula C8H11Cl2FN2 and a molecular weight of 225.09 g/mol. IUPAC name: 5-chloro-3-fluoro-N-propan-2-ylpyridin-2-amine;hydrochloride. InChIKey: XAVUHMPTJMMNGC-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2FN2 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 5-chloro-3-fluoro-N-propan-2-ylpyridin-2-amine;hydrochloride |
| InChIKey | XAVUHMPTJMMNGC-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=N1)Cl)F.Cl |
Computed by PubChem (NCBI)