Products 191592-09-3
CAS 191592-09-3 appears in our catalog under these names: 5-HT2 antagonist 1/ 99.25% (existing batch purity), 5–HT2 antagonist 1, 5-HT2 antagonist 1. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 1 mg.
5-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one (CAS 191592-09-3) is a chemical compound with the molecular formula C22H29FN4O2 and a molecular weight of 400.5 g/mol. IUPAC name: 5-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one. InChIKey: KBZUFSZQLVRGPR-UHFFFAOYSA-N.
| Molecular formula | C22H29FN4O2 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 5-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-hydroxy-1-methyl-7,8-dihydro-6H-pyrrolo[3,2-c]azepin-4-one |
| InChIKey | KBZUFSZQLVRGPR-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C(CCN(C2=O)CCCN3CCN(CC3)C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)