Products 120635-47-4
CAS 120635-47-4 appears in our catalog under these names: 5-HT3 antagonist 3/ 99.69% (existing batch purity), Imidazol–1–yl compound 1, 5-HT3 antagonist 3. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
12-[(2-methylimidazol-1-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-11-one (CAS 120635-47-4) is a chemical compound with the molecular formula C20H21N3O and a molecular weight of 319.4 g/mol. IUPAC name: 12-[(2-methylimidazol-1-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-11-one. InChIKey: NCNFDKWULDWJDS-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 12-[(2-methylimidazol-1-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraen-11-one |
| InChIKey | NCNFDKWULDWJDS-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1CC2CCC3=C(C2=O)C4=CC=CC5=C4N3CCC5 |
Computed by PubChem (NCBI)