Products 261766-73-8
CAS 261766-73-8 appears in our catalog under these names: 5-HT4 antagonist 1/ 99.86% (existing batch purity), 5–HT4 antagonist 1, 5-HT4 antagonist 1, 5-HT4 antagonist 1, 98.95%, 5-HT4 antagonist 1 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
N-[[1-[3-(4-methylpiperazin-1-yl)sulfonylpropyl]piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide (CAS 261766-73-8) is a chemical compound with the molecular formula C23H36N4O5S and a molecular weight of 480.6 g/mol. IUPAC name: N-[[1-[3-(4-methylpiperazin-1-yl)sulfonylpropyl]piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide. InChIKey: AUXZCLHKLUWDDZ-UHFFFAOYSA-N.
| Molecular formula | C23H36N4O5S |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | N-[[1-[3-(4-methylpiperazin-1-yl)sulfonylpropyl]piperidin-4-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| InChIKey | AUXZCLHKLUWDDZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)CCCN2CCC(CC2)CNC(=O)C3=C4C(=CC=C3)OCCO4 |
Computed by PubChem (NCBI)