5-Hydroxy-2-(trifluoromethoxy)phenylboronic acid, 98%
cas: 1217500-69-0 — see every product listed under this CAS number, including other names
5-Hydroxy-2-(trifluoromethoxy)phenylboronic acid, 98% (CAS 1217500-69-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Ambeed.
| brand | Chemat |
|---|---|
| catalog number | Ch1126R4-100mg |
| cas | 1217500-69-0 |
| size | 100mg |
| availability | 15g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 842.00 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 898.81 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 842.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[5-hydroxy-2-(trifluoromethoxy)phenyl]boronic acid (CAS 1217500-69-0) is a chemical compound with the molecular formula C7H6BF3O4 and a molecular weight of 221.93 g/mol. IUPAC name: [5-hydroxy-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: GRXHOVJTALGZII-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O4 |
|---|---|
| Molecular weight | 221.93 g/mol |
| IUPAC name | [5-hydroxy-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | GRXHOVJTALGZII-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)O)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)