cas: 71186-53-3 — see every product listed under this CAS number, including other names
5-Hydroxydecanoate sodium 98% (CAS 71186-53-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A913675-25mg |
| cas | 71186-53-3 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 203.50 Pln | |
| Ambeed | 50mg | 225.75 Pln | |
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 4264.13 Pln | |
| Ambeed | 10g | 6783.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A913675 |
Sodium 5-hydroxydecanoate (CAS 71186-53-3) is a chemical compound with the molecular formula C10H19NaO3 and a molecular weight of 210.25 g/mol. IUPAC name: sodium 5-hydroxydecanoate. InChIKey: YNAGNECWEKMWRM-UHFFFAOYSA-M.
| Molecular formula | C10H19NaO3 |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | sodium 5-hydroxydecanoate |
| InChIKey | YNAGNECWEKMWRM-UHFFFAOYSA-M |
| SMILES | CCCCCC(CCCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)