CAS 71186-53-3 appears in our catalog under these names: 5-Hydroxydecanoate Sodium Salt, 5-Hydroxydecanoate sodium, 5–Hydroxydecanoate sodium, 5-Hydroxydecanoic acid sodium , 5-Hydroxydecanoic acid sodium. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 50mg, 200mg, 500mg, 0,1g.
Sodium 5-hydroxydecanoate (CAS 71186-53-3) is a chemical compound with the molecular formula C10H19NaO3 and a molecular weight of 210.25 g/mol. IUPAC name: sodium 5-hydroxydecanoate. InChIKey: YNAGNECWEKMWRM-UHFFFAOYSA-M.
| Molecular formula | C10H19NaO3 |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | sodium 5-hydroxydecanoate |
| InChIKey | YNAGNECWEKMWRM-UHFFFAOYSA-M |
| SMILES | CCCCCC(CCCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)