cas: 106877-29-6 — see every product listed under this CAS number, including other names
5-METHYL-2-(TRIFLUOROMETHYL)ANILINE, 98% (CAS 106877-29-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F825518-250MG |
| cas | 106877-29-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1237.08 Pln | |
| Fluorochem | 25g | 3017.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-methyl-2-(trifluoromethyl)aniline (CAS 106877-29-6) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 5-methyl-2-(trifluoromethyl)aniline. InChIKey: HYQKJEMNTMFLJA-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethyl)aniline |
| InChIKey | HYQKJEMNTMFLJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)