CAS 57078-99-6 appears in our catalog under these names: 5-(2,5-Dioxo-2,5-dihydro-1h-pyrrol-1-yl)pentanoic acid, 95%, 5-Maleimidopentanoic Acid, 5–Maleimidovaleric acid, 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid, 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 50mg, 2,5g, 5g, 1 g.
5-(2,5-dioxopyrrol-1-yl)pentanoic acid (CAS 57078-99-6) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 5-(2,5-dioxopyrrol-1-yl)pentanoic acid. InChIKey: ACVAAFHNDGTZLL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 5-(2,5-dioxopyrrol-1-yl)pentanoic acid |
| InChIKey | ACVAAFHNDGTZLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCC(=O)O |
Computed by PubChem (NCBI)