cas: 828-94-4 — see every product listed under this CAS number, including other names
5-Methoxy-2,3-dimethyl-1H-indole, 98% (CAS 828-94-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A194665-10g |
| cas | 828-94-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19196.38 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 500mg | 1648.40 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 2.5g | 4933.70 Pln | |
| Fluorochem | 5g | 6099.95 Pln | |
| Fluorochem | 10g | 11910.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methoxy-2,3-dimethyl-1H-indole (CAS 828-94-4) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 5-methoxy-2,3-dimethyl-1H-indole. InChIKey: GZSTUEGIANKNTE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 5-methoxy-2,3-dimethyl-1H-indole |
| InChIKey | GZSTUEGIANKNTE-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=C(C=C2)OC)C |
Computed by PubChem (NCBI)