cas: 2197053-36-2 — see every product listed under this CAS number, including other names
5-Methoxy-2H-spiro(benzofuran-3,4'-piperidine) hydrochloride, 98% (CAS 2197053-36-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2255702-1g |
| cas | 2197053-36-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 17842.30 Pln | |
| AmBeed | 250mg | 7178.92 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methoxyspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride (CAS 2197053-36-2) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 5-methoxyspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: MTVMGDITVBECGE-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 5-methoxyspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | MTVMGDITVBECGE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC23CCNCC3.Cl |
Computed by PubChem (NCBI)