Products 2365419-16-3
CAS 2365419-16-3 is the registry number for 1-Benzyl-3-methylpyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-benzyl-3-methylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 2365419-16-3) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 1-benzyl-3-methylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: OFQPBUIEUUGTCJ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 1-benzyl-3-methylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | OFQPBUIEUUGTCJ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1)CC2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)