5-Methoxycarbonylthiophene-2-boronic acid, 95%, 95%
cas: 876189-21-8 — see every product listed under this CAS number, including other names
5-Methoxycarbonylthiophene-2-boronic acid, 95%, 95% (CAS 876189-21-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MU0-100mg |
| cas | 876189-21-8 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 2027.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5-methoxycarbonylthiophen-2-yl)boronic acid (CAS 876189-21-8) is a chemical compound with the molecular formula C6H7BO4S and a molecular weight of 186.00 g/mol. IUPAC name: (5-methoxycarbonylthiophen-2-yl)boronic acid. InChIKey: VJWFTDBWRPSNFS-UHFFFAOYSA-N.
| Molecular formula | C6H7BO4S |
|---|---|
| Molecular weight | 186.00 g/mol |
| IUPAC name | (5-methoxycarbonylthiophen-2-yl)boronic acid |
| InChIKey | VJWFTDBWRPSNFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Methoxycarbonylthiophene-2-boronic acid, (5-(methoxycarbonyl)thiophen-2-yl)boronic acid, 5-(methoxycarbonyl)thiophen-2-ylboronic acid, (5-methoxycarbonylthiophen-2-yl)boronic Acid, Thiophene-2-carboxylic acid methyl ester-5-boric acid, Thiophene-2-carboxylic acid methyl ester-5-boronic acid, [5-(Methoxycarbonyl)thiophen-2-yl]boronic acid, 5-Methoxycarbonylthiophene-2-boronicacid, 2-Thiophenecarboxylic acid, 5-borono-, 2-methyl ester, (5-methoxycarbonyl-2-thienyl)boronic acid