5-Methyl-2-propoxybenzoic acid, 98%
cas: 93351-66-7 — see every product listed under this CAS number, including other names
5-Methyl-2-propoxybenzoic acid, 98% (CAS 93351-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A767751-100mg |
| cas | 93351-66-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 964.13 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 774.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-methyl-2-propoxybenzoic acid (CAS 93351-66-7) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 5-methyl-2-propoxybenzoic acid. InChIKey: AGFPDQMSANRAMF-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-methyl-2-propoxybenzoic acid |
| InChIKey | AGFPDQMSANRAMF-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C)C(=O)O |
Computed by PubChem (NCBI)
