cas: 82517-12-2 — see every product listed under this CAS number, including other names
5-Methyl-7-methoxyisoflavone (CAS 82517-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 20mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1168O8-1g |
| cas | 82517-12-2 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 25g | 2253.20 Pln | |
| Chemat | 100g | 5901.20 Pln | |
| Chemat | 20mg | 170.00 Pln | |
| Fluorochem | 1g | 404.04 Pln |
| delivery time | 3 weeks |
|---|
7-methoxy-5-methyl-3-phenylchromen-4-one (CAS 82517-12-2) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: 7-methoxy-5-methyl-3-phenylchromen-4-one. InChIKey: WGOUYULOZZRTFS-UHFFFAOYSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 7-methoxy-5-methyl-3-phenylchromen-4-one |
| InChIKey | WGOUYULOZZRTFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=O)C(=CO2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)