CAS 374912-51-3 is the registry number for 5-Methoxy-2-methyl-3-phenyl-1-benzofuran-6-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-methoxy-2-methyl-3-phenyl-1-benzofuran-6-carbaldehyde (CAS 374912-51-3) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: 5-methoxy-2-methyl-3-phenyl-1-benzofuran-6-carbaldehyde. InChIKey: QDELYQWIZDKRMY-UHFFFAOYSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 5-methoxy-2-methyl-3-phenyl-1-benzofuran-6-carbaldehyde |
| InChIKey | QDELYQWIZDKRMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C=C(C(=C2)OC)C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)