CAS 608-05-9 appears in our catalog under these names: 5–Methylisatin, 5-Methylisatin, 97% , 5-Methylisatin, >99.0%(GC), 5-Methylisatin, 95%, 5-Methylisatin 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 500g, 1g, 5g, 25g, 10g.
5-methyl-1H-indole-2,3-dione (CAS 608-05-9) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 5-methyl-1H-indole-2,3-dione. InChIKey: VAJCSPZKMVQIAP-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-methyl-1H-indole-2,3-dione |
| InChIKey | VAJCSPZKMVQIAP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)