cas: 937012-11-8 — see every product listed under this CAS number, including other names
5-Nitro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97% (CAS 937012-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTY0-100mg |
| cas | 937012-11-8 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 500mg | 414.80 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1456.40 Pln | |
| Chemat | 10g | 2382.80 Pln | |
| Chemat | 25g | 4706.00 Pln | |
| Chemat | 100g | 11666.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine (CAS 937012-11-8) is a chemical compound with the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine. InChIKey: WLSHPXXCDBYQNM-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O4S |
|---|---|
| Molecular weight | 303.30 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine |
| InChIKey | WLSHPXXCDBYQNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=CN=C32)[N+](=O)[O-] |
Computed by PubChem (NCBI)