CAS 937012-11-8 appears in our catalog under these names: 5-Nitro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 5-Nitro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine (CAS 937012-11-8) is a chemical compound with the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine. InChIKey: WLSHPXXCDBYQNM-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O4S |
|---|---|
| Molecular weight | 303.30 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridine |
| InChIKey | WLSHPXXCDBYQNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=CN=C32)[N+](=O)[O-] |
Computed by PubChem (NCBI)