cas: 158579-82-9 — see every product listed under this CAS number, including other names
5-Nitro-2-(trifluoromethoxy)aniline 98% (CAS 158579-82-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A224174-1g |
| cas | 158579-82-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 370.38 Pln | |
| Ambeed | 10g | 526.12 Pln | |
| Ambeed | 25g | 1099.06 Pln | |
| Ambeed | 100g | 4180.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A224174 |
5-nitro-2-(trifluoromethoxy)aniline (CAS 158579-82-9) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 5-nitro-2-(trifluoromethoxy)aniline. InChIKey: QMEGHVYHZCJNOH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 5-nitro-2-(trifluoromethoxy)aniline |
| InChIKey | QMEGHVYHZCJNOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)OC(F)(F)F |
Computed by PubChem (NCBI)