Products 1341937-69-6

CAS 1341937-69-6 is the registry number for 3-(2,2,2-Trifluoroethoxy)pyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid (CAS 1341937-69-6) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid. InChIKey: WBVZBSNIQUHNHV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F3N2O3
Molecular weight222.12 g/mol
IUPAC name3-(2,2,2-trifluoroethoxy)pyrazine-2-carboxylic acid
InChIKeyWBVZBSNIQUHNHV-UHFFFAOYSA-N
SMILESC1=CN=C(C(=N1)C(=O)O)OCC(F)(F)F

Computed by PubChem (NCBI)