cas: 25948-11-2 — see every product listed under this CAS number, including other names
5-Nitro-N-propylpyridin-2-amine, 99%, 99% (CAS 25948-11-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113R6S-1g |
| cas | 25948-11-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 25g | 2498.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5-nitro-N-propylpyridin-2-amine (CAS 25948-11-2) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 5-nitro-N-propylpyridin-2-amine. InChIKey: KZWODZHPEMBNTR-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-nitro-N-propylpyridin-2-amine |
| InChIKey | KZWODZHPEMBNTR-UHFFFAOYSA-N |
| SMILES | CCCNC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)