CAS 51138-16-0 appears in our catalog under these names: N-(2-Aminoethyl)-2-nitroaniline, 98%, N-(2-Nitrophenyl)ethane-1,2-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N'-(2-nitrophenyl)ethane-1,2-diamine (CAS 51138-16-0) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: N'-(2-nitrophenyl)ethane-1,2-diamine. InChIKey: OQOLYTBWYAUNJX-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | N'-(2-nitrophenyl)ethane-1,2-diamine |
| InChIKey | OQOLYTBWYAUNJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)