5-Nitrobenzo[c][1,2,5]thiadiazol-4-amine, 95+%
cas: 1915-85-1 — see every product listed under this CAS number, including other names
5-Nitrobenzo[c][1,2,5]thiadiazol-4-amine, 95+% (CAS 1915-85-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A895364-50mg |
| cas | 1915-85-1 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 248.00 Pln | |
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1544.06 Pln | |
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1643.60 Pln | |
| BLDpharm | 50mg | 269.93 Pln | |
| BLDpharm | 100mg | 408.77 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1691.65 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
5-nitro-2,1,3-benzothiadiazol-4-amine (CAS 1915-85-1) is a chemical compound with the molecular formula C6H4N4O2S and a molecular weight of 196.19 g/mol. IUPAC name: 5-nitro-2,1,3-benzothiadiazol-4-amine. InChIKey: ZBOFIKFTNZRPGB-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 5-nitro-2,1,3-benzothiadiazol-4-amine |
| InChIKey | ZBOFIKFTNZRPGB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)